On Target NS5B_HCV1B 0.29957807/CHEMBL3645205
For the given ligand ICV806, we have found in our database that, being scored 0.29957807, the most similar ligand is CHEMBL3645205. Check out the elaboration below.
| ICV806 (Given Ligand) | CHEMBL3645205 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cc(F)cc(NC(=O)N3CCN(C)CC3)c4)CC5 | CNC(=O)c1c2cc(C3CC3)c(N(CCC(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(F)cc1 |
|
|
|
|
|
|
| 10020006 01802000 00100100 06010e00 04000100 08000010 00000004 22003009 08a00000 000a68d0 08280004 70039000 0401a802 08103000 00000460 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000001 00000000 90000081 08408100 00068003 20040000 00804600 | 00004006 00805e08 20180902 43310e00 210c0000 00004052 22040000 02001408 00100900 004908c0 09312034 50119800 88008c23 01401201 810a0040 000e200e 0426c004 02400004 08e00018 00224205 c0100101 1c838e38 21801880 9360001c 02104080 c0000040 00270080 8000108d 0c488304 0046804b c4048080 a01147e0 |