On Target NS5B_HCV1B 0.30131003/CHEMBL3645210
For the given ligand ICV804, we have found in our database that, being scored 0.30131003, the most similar ligand is CHEMBL3645210. Check out the elaboration below.
| ICV804 (Given Ligand) | CHEMBL3645210 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cccc(NC(=O)N3CCN(C)CC3)c4)CC5 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)C3CCC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 10020006 01802000 00100100 04010e00 04000000 08000000 00000004 22003009 00a00000 000a08d0 08280004 50039000 0400a802 08102000 00000440 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000000 00000000 90000080 08408100 00060003 20040000 00804600 | 00014006 0180de08 20180902 41310e00 210c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c33 01400211 808a0040 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8b8e38 2080c800 9370001c 02104080 c0000048 00270080 9000108c 0c488104 0046005b c4048088 a81167e0 |