On Target NS5B_HCV1A 0.39655173/CHEMBL3644925
For the given ligand ICV804, we have found in our database that, being scored 0.39655173, the most similar ligand is CHEMBL3644925. Check out the elaboration below.
| ICV804 (Given Ligand) | CHEMBL3644925 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cccc(NC(=O)N3CCN(C)CC3)c4)CC5 | CCC[C@H](NC(=O)[C@@H]1CN(c2ccc(-c3ccccc3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 10020006 01802000 00100100 04010e00 04000000 08000000 00000004 22003009 00a00000 000a08d0 08280004 50039000 0400a802 08102000 00000440 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000000 00000000 90000080 08408100 00060003 20040000 00804600 | 00016006 01403c00 00100120 04010f00 20080000 00018000 00000004 a0002009 04800200 00020be0 00200004 5001b000 0e00b00a 0100a101 80020040 001a0008 00860010 02482001 0c402850 00000a01 60100100 380f0e10 31020003 0250001a 00113000 80001002 00000000 102000e0 0800c200 01060013 a0184000 00006200 |