On Target RT_HIV1 0.3272727/CHEMBL4225865
For the given ligand ICV806, we have found in our database that, being scored 0.3272727, the most similar ligand is CHEMBL4225865. Check out the elaboration below.
| ICV806 (Given Ligand) | CHEMBL4225865 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cc(F)cc(NC(=O)N3CCN(C)CC3)c4)CC5 | C=C(C)[C@@H]1CC[C@]2(CN(CCN(C)C)C(=O)CCC(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 10020006 01802000 00100100 06010e00 04000100 08000010 00000004 22003009 08a00000 000a68d0 08280004 70039000 0401a802 08103000 00000460 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000001 00000000 90000081 08408100 00068003 20040000 00804600 | 00060000 01003800 00100302 44050600 00100000 00004000 80000080 2000040a 00000900 001808c0 08300000 40019800 04028002 00202000 00000402 00080008 00000400 02000020 02412000 00000201 01000100 38060e30 01008021 0250001c 01200000 80000000 00406000 d0000000 08400002 01060003 e4020000 00802e00 |