On Target RT_HIV1 0.34751773/CHEMBL4227382
For the given ligand ICV803, we have found in our database that, being scored 0.34751773, the most similar ligand is CHEMBL4227382. Check out the elaboration below.
| ICV803 (Given Ligand) | CHEMBL4227382 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cccc(NC(=O)CN(C)C)c3)CC4 | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 10024002 01800000 40100120 00010600 04000000 08000000 00000000 22001000 00a00000 00080ad0 08280004 5003b000 04008802 00102000 00000440 00000000 00040000 02000000 08000000 00000201 c0100000 38008608 20002000 0050001a 00040000 c0000000 00000000 90000080 08408100 00060003 20044000 00800600 | 00004002 01000c00 00100302 40050600 20000000 00004000 80000080 20000402 00000900 001809e0 08300004 40018800 00028002 00200000 00020442 00080008 00040400 02000020 0a012000 00000201 61100100 18020a30 20008020 00500014 01200000 80000000 00406000 d0000080 00408002 01060012 e4020000 00002600 |