On Target RT_HIV1 0.4144144/CHEMBL3828596
For the given ligand ICV802, we have found in our database that, being scored 0.4144144, the most similar ligand is CHEMBL3828596. Check out the elaboration below.
| ICV802 (Given Ligand) | CHEMBL3828596 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCC3CCN(C)CC3)CC4 | C=C(C)[C@@H]1CC[C@]2(CNCCCN3CCCC3=O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00020000 01001000 00100100 00010600 00000000 00000000 00000000 22001000 00200000 000808c0 08200000 50039000 04008802 00000000 00000400 00000000 00000000 02000000 00000000 00000201 00000000 18048608 00000000 00500018 00000000 c0000000 00000000 90000000 00000100 00060003 20040000 00802600 | 00020000 01001c00 00100302 40050600 00000000 00004010 80000080 20000402 00000900 001809e0 08300000 40019800 04028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 180a0e30 00008020 0050001c 01200000 80000000 00406000 d0000000 00400002 01060013 e4020000 00802600 |