On Target PR_HIV1 0.2038835/CHEMBL523528
For the given ligand ICV805, we have found in our database that, being scored 0.2038835, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| ICV805 (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cc(F)cc(NC(=O)CN(C)C)c3)CC4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 10024002 01800000 40100120 02010600 04000100 08000010 00000000 22001000 04a00000 00086ad0 08280004 7003b000 04018802 00103000 00000460 00000000 00040000 02000000 08000000 00000201 c0100000 38008608 20002000 0050001a 00040000 c0000001 00000000 90000081 08408100 00068003 20044000 00800600 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |