On Target PR_HIV1 0.2/CHEMBL492666
For the given ligand ICV804, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| ICV804 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cccc(NC(=O)N3CCN(C)CC3)c4)CC5 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 10020006 01802000 00100100 04010e00 04000000 08000000 00000004 22003009 00a00000 000a08d0 08280004 50039000 0400a802 08102000 00000440 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000000 00000000 90000080 08408100 00060003 20040000 00804600 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |