On Target PA_INFA 0.37984496/CHEMBL463590
For the given ligand ICV803, we have found in our database that, being scored 0.37984496, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| ICV803 (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cccc(NC(=O)CN(C)C)c3)CC4 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 10024002 01800000 40100120 00010600 04000000 08000000 00000000 22001000 00a00000 00080ad0 08280004 5003b000 04008802 00102000 00000440 00000000 00040000 02000000 08000000 00000201 c0100000 38008608 20002000 0050001a 00040000 c0000000 00000000 90000080 08408100 00060003 20044000 00800600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |