On Target NS3_HCV1B 0.30582523/CHEMBL3954962
For the given ligand ICV806, we have found in our database that, being scored 0.30582523, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| ICV806 (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cc(F)cc(NC(=O)N3CCN(C)CC3)c4)CC5 | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 10020006 01802000 00100100 06010e00 04000100 08000010 00000004 22003009 08a00000 000a68d0 08280004 70039000 0401a802 08103000 00000460 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000001 00000000 90000081 08408100 00068003 20040000 00804600 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |