On Target ACE2_HUMAN 0.44791666/CHEMBL400527
For the given ligand ICV802, we have found in our database that, being scored 0.44791666, the most similar ligand is CHEMBL400527. Check out the elaboration below.
| ICV802 (Given Ligand) | CHEMBL400527 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCC3CCN(C)CC3)CC4 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc2ccccc12)C(=O)O |
|
|
|
|
|
|
| 00020000 01001000 00100100 00010600 00000000 00000000 00000000 22001000 00200000 000808c0 08200000 50039000 04008802 00000000 00000400 00000000 00000000 02000000 00000000 00000201 00000000 18048608 00000000 00500018 00000000 c0000000 00000000 90000000 00000100 00060003 20040000 00802600 | 00010000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10000000 02000000 00400008 00000201 00000100 18200e08 03000140 85500018 00000800 80000000 00000000 10000040 04000000 00060003 20004000 03012600 |