On Target NS3_HCV1A 0.3939394/CHEMBL3974326
For the given ligand ICV805, we have found in our database that, being scored 0.3939394, the most similar ligand is CHEMBL3974326. Check out the elaboration below.
| ICV805 (Given Ligand) | CHEMBL3974326 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N4CCC(C(=O)NCc3cc(F)cc(NC(=O)CN(C)C)c3)CC4 | CC(C)c1ccc2c(Nc3cc(C(=O)Nc4ccc(NC(=O)C5CCCN5)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 10024002 01800000 40100120 02010600 04000100 08000010 00000000 22001000 04a00000 00086ad0 08280004 7003b000 04018802 00103000 00000460 00000000 00040000 02000000 08000000 00000201 c0100000 38008608 20002000 0050001a 00040000 c0000001 00000000 90000081 08408100 00068003 20044000 00800600 | 1001400a 01803a00 001a4120 1c190600 24040020 08006010 00009010 02001800 10802100 00080ad0 08389004 6081f800 06008812 00912000 80020040 1a0c0006 04041000 72004001 0860000a 12200201 c1100000 380e8660 20816041 8258001f 00044000 80000200 022080d0 90800080 2840830c 01460003 c004c000 200106e0 |