On Target NS3_HCV1A 0.36216217/CHEMBL3645761
For the given ligand ICV804, we have found in our database that, being scored 0.36216217, the most similar ligand is CHEMBL3645761. Check out the elaboration below.
| ICV804 (Given Ligand) | CHEMBL3645761 (Similar Ligand) |
|---|---|
| C[C@H](c1cccc2ccccc12)N5CCC(C(=O)NCc4cccc(NC(=O)N3CCN(C)CC3)c4)CC5 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1nccc3ccccc13)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 10020006 01802000 00100100 04010e00 04000000 08000000 00000004 22003009 00a00000 000a08d0 08280004 50039000 0400a802 08102000 00000440 00000000 00040010 02400000 08000000 00000201 c0000100 38018608 20022020 02500018 00140000 c0000000 00000000 90000080 08408100 00060003 20040000 00804600 | 000180a2 09003800 06104100 15210e00 00040020 00100010 000a0000 22003409 10000000 0011c9c8 00692004 4001b000 0601881a 01502011 a0420440 02040104 04004000 02000002 46212000 00004201 40000000 38078638 20802003 b2d0003c 00100000 c0000000 00000040 90000010 08000104 c0060081 e4064004 00016260 |