On Target NSP1_SARS 0.21052632/CHEMBL1092796
For the given ligand ICV811, we have found in our database that, being scored 0.21052632, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| ICV811 (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C(Cl)\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00430013 09049000 08104000 00000c00 42155000 04300401 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00402801 30040780 80009400 0410081a 00700000 08008800 41484280 900c0200 06000001 80040401 1c000000 46823280 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |