On Target NP_HCoV-OC43 0.13488372/CHEMBL3233481
For the given ligand ICV810, we have found in our database that, being scored 0.13488372, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV810 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=C3/C(C1/C=C\C=C(Cl)/C1)=C\C(c2c[nH]c(=O)[nH]c2=O)CN3C4/C=N\C=C/C4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00430013 0904b000 01105000 03002e10 4215d002 04b04001 50182180 20020416 17400180 029980a9 24a30004 41411200 0402a102 08410000 02200400 000c0804 20004800 12808340 40610082 43420209 00002001 10200780 a0809040 14100c1a 00240000 cc000000 61484000 90040000 06004000 80460401 54000000 468232c0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |