On Target NA_INFB 0.3106383/CHEMBL348066
For the given ligand ICV808, we have found in our database that, being scored 0.3106383, the most similar ligand is CHEMBL348066. Check out the elaboration below.
| ICV808 (Given Ligand) | CHEMBL348066 (Similar Ligand) |
|---|---|
| CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 | CCCN(CCc1ccccc1)C(=O)[C@@H]1OC(C(=O)O)=C[C@H](N)[C@H]1NC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00010082 41040000 00100300 000d0601 40050011 00205001 82000180 a2001400 01000100 001088c0 c0200200 40419210 94028800 200b4000 02000406 0a08040c 22200404 02000100 2089e090 00028201 01002021 5800d620 4140a020 a0400912 01401400 80002000 00486040 d0002020 00404340 004e0400 44060000 06000210 | 00030000 89007600 00100101 80010701 00000081 000003c0 00080180 38800c04 01200080 801889e8 88200000 4003d200 8c028002 00480000 02081408 38099008 30200004 82000141 40c14010 00002205 00004020 382a0f80 17008000 8b70001c 00001400 80000c00 00c04000 90000121 0c004200 00060413 0c040000 00006600 |