On Target NS5B_HCV1A 0.23411371/CHEMBL3644934
For the given ligand ICV810, we have found in our database that, being scored 0.23411371, the most similar ligand is CHEMBL3644934. Check out the elaboration below.
| ICV810 (Given Ligand) | CHEMBL3644934 (Similar Ligand) |
|---|---|
| O=C3/C(C1/C=C\C=C(Cl)/C1)=C\C(c2c[nH]c(=O)[nH]c2=O)CN3C4/C=N\C=C/C4 | CC(C)(C)OC(=O)N[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2CN(c3ccc(-c4ccccc4)cc3)CN2C1=O |
|
|
|
|
|
|
| 00430013 0904b000 01105000 03002e10 4215d002 04b04001 50182180 20020416 17400180 029980a9 24a30004 41411200 0402a102 08410000 02200400 000c0804 20004800 12808340 40610082 43420209 00002001 10200780 a0809040 14100c1a 00240000 cc000000 61484000 90040000 06004000 80460401 54000000 468232c0 | 00016086 0d403c00 00100120 05310e00 20000000 00018000 000a0004 2000340b 10800200 00528be8 00202404 5101b000 0e02f00a 0104a001 80420440 001a8008 02064010 02482040 4c212850 02004a01 60100100 bc070e50 30028003 3254003a 02312000 80000002 00404000 902000ec 0c00c200 80060491 a41a4000 01016270 |