On Target RT_HIV1 0.21212122/CHEMBL4112133
For the given ligand ICV811, we have found in our database that, being scored 0.21212122, the most similar ligand is CHEMBL4112133. Check out the elaboration below.
| ICV811 (Given Ligand) | CHEMBL4112133 (Similar Ligand) |
|---|---|
| N#CC1/C=C\C=C/C1C4/C=C(C2/C=C(Cl)\C=C(Cl)/C2)\C(=O)N(C3/C=N\C=C/C3)C4 | COC(=O)N[C@H](C(=O)N[C@H](c1ccc([C@@H](CO)N(CCC(C)(C)C)S(=O)(=O)C2=CC3NC=C(Cl)C3C=C2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00430013 09049000 08104000 00000c00 42155000 04300401 50180180 30020402 11000000 02108089 00230000 41411200 0402a102 08010000 02000400 00000104 20404800 10800340 40010082 03420209 00402801 30040780 80009400 0410081a 00700000 08008800 41484280 900c0200 06000001 80040401 1c000000 46823280 | 00432021 4c94b201 06380100 45310603 500100c0 0033b9e5 400811a1 3348541e 00c61f08 c05918c2 49342600 c070ba80 bc068892 80652021 804c2400 001e024c 38c31000 0219194c 80300098 00804a0d c0003b41 7c288f90 43309100 d3700e7a 46800800 ec010002 40420801 d064213c 0c700390 400e070f e4004100 41c347f0 |