On Target PA_INFA 0.2925532/CHEMBL463590
For the given ligand ICV808, we have found in our database that, being scored 0.2925532, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| ICV808 (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| CNCc3ccc(/C2=C/C1/C=C(F)\C=C(C(N)=O)/C1O2)cc3 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00010082 41040000 00100300 000d0601 40050011 00205001 82000180 a2001400 01000100 001088c0 c0200200 40419210 94028800 200b4000 02000406 0a08040c 22200404 02000100 2089e090 00028201 01002021 5800d620 4140a020 a0400912 01401400 80002000 00486040 d0002020 00404340 004e0400 44060000 06000210 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |