On Target NS3_HCV1A 0.25108224/CHEMBL3696817
For the given ligand ICV807, we have found in our database that, being scored 0.25108224, the most similar ligand is CHEMBL3696817. Check out the elaboration below.
| ICV807 (Given Ligand) | CHEMBL3696817 (Similar Ligand) |
|---|---|
| O=C(OC4OC(OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c3cc(O)c(O)c(O)c3)C4OC(=O)c5cc(O)c(O)c(O)c5)c6cc(O)c(O)c(O)c6 | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(OC(C)C)O[C@H]2[C@@]1(C)N |
|
|
|
|
|
|
| 00000001 49000808 a0000509 00810b00 88280050 00004000 02002800 08002040 00202100 010008e8 04000000 40018000 00008002 02010000 00000000 222a9008 00820000 02000000 11408000 00020a01 00100020 18070a30 05000000 08500014 00000400 c0002000 004a0000 24000020 00000200 0002000a c0a00000 02000000 | 0000400a 01c01818 60080318 c1810f00 80180064 0008c004 1400ec41 80403808 00404100 818000f0 0c00900c 40059000 00001104 0b8a0120 01881884 101d8e0c 002e0020 00800008 39c00000 00247003 800a0020 3c000850 27800840 08400814 18000c40 40000202 0e060200 10010060 00000208 0046101c d1e84000 08298080 |