On Target PR_HIV1 0.20065789/CHEMBL494500
For the given ligand ICV819, we have found in our database that, being scored 0.20065789, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| ICV819 (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| CC(C)CCO/C4=C/C(Cl)=C\C(\C3=C\C(c1c[nH]c(=O)[nH]c1=O)CN(C2/C=N\C=C/C2)C3=O)C4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 00410052 8904b000 09105000 83012f11 424db002 04b05401 10182180 20020416 17400188 029980e9 24a30004 41419200 8402a122 09410000 02200400 010d180c 20824804 42008340 40614082 43422209 00002821 10200780 a1809040 14100c1a 00740400 cc008800 61484080 90040600 04004241 80460401 5c010800 460222c0 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |