On Target NA_INFB 0.32222223/CHEMBL113191
For the given ligand ICV828, we have found in our database that, being scored 0.32222223, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| ICV828 (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| O=C4/C(C2/C=C(Cl)\C=C(OCc1ccc(F)cc1Cl)/C2)=C\C(c3c[nH]c(=O)[nH]c3=O)CN4C5/C=N\C=C/C5 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00418012 8905b000 09105100 83012f11 464db012 04b05411 30182180 20024416 17400188 029988e9 24a30004 41419a00 8602a126 09411004 02200400 020d180c 20825800 42008340 40614082 43522209 00003821 182007a0 a1809040 94500c1a 00742400 cc00aa00 61484080 90040601 04004201 80468401 5c010800 460222c0 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |