On Target RT_HIV1 0.29761904/CHEMBL4225865
For the given ligand ICV835, we have found in our database that, being scored 0.29761904, the most similar ligand is CHEMBL4225865. Check out the elaboration below.
| ICV835 (Given Ligand) | CHEMBL4225865 (Similar Ligand) |
|---|---|
| C=Cc4cc(C(=O)Nc1ccc(C(=N)N)cc1)c(C3/C=C\C(C(=O)NCC2CC2)=N/C3C(=O)O)cc4OC | C=C(C)[C@@H]1CC[C@]2(CN(CCN(C)C)C(=O)CCC(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 0008400a ca083c18 20b04109 90110700 00221023 c0808000 932c10c1 3202142a 82000964 009808cb 083a0004 4100f800 0402a882 2130a000 01000041 28582088 02240814 42100042 08688008 02422a61 41d20100 38068e40 a305f040 8140001c 00220800 a0000009 48622000 94400880 0c608318 81a60403 c4040020 04002604 | 00060000 01003800 00100302 44050600 00100000 00004000 80000080 2000040a 00000900 001808c0 08300000 40019800 04028002 00202000 00000402 00080008 00000400 02000020 02412000 00000201 01000100 38060e30 01008021 0250001c 01200000 80000000 00406000 d0000000 08400002 01060003 e4020000 00802e00 |