On Target GP_EBOV 0.1767442/CHEMBL3125897
For the given ligand ICV837, we have found in our database that, being scored 0.1767442, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| ICV837 (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CC(C)N=c4cc2c(=NC1/C=C\C=C/C1N2c3ccc(Cl)cc3)cc4Nc5ccc(Cl)cc5 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00020042 09448000 00304040 00001c00 44b00000 00000005 10180000 20022410 00200001 20110489 00270000 40430200 00122002 00012000 00800000 00000000 22000810 00000140 12002080 01420221 00002001 30030110 c0029003 02100810 00020080 08020002 40480000 90000000 08000000 004c8400 04000000 06822a00 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |