On Target NS3_HCV1B 0.2585034/CHEMBL3125634
For the given ligand ICV842, we have found in our database that, being scored 0.2585034, the most similar ligand is CHEMBL3125634. Check out the elaboration below.
| ICV842 (Given Ligand) | CHEMBL3125634 (Similar Ligand) |
|---|---|
| Cc3ccc(C(=O)Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12)cc3NC(=O)c8cccc(NC(=O)Nc7cccc(C(=O)Nc6cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)ccc6C)c7)c8 | CC(C)(C)NC(=O)Nc1nc(Cl)c(CCC2CCCCC2)n(CC(=O)Nc2ccccc2C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1=O |
|
|
|
|
|
|
| 1000c006 00c02800 40000100 40d10e40 04000200 0c020040 00000000 02003209 00881100 00080850 00682004 6000c020 80008800 08100402 80220340 10000000 00040000 02000000 08000000 00002000 c0100102 08228608 20032000 0854000c 00140000 80000000 00000910 d00010c0 24408100 40060001 82040000 00014220 | 1001403a 05801800 011815e2 51b50e30 0408014c 08016040 0500ac05 00883101 16e00a01 f0083af0 08b8a06c 6010b980 05088808 03700801 80a309c2 08140004 8e246080 46504000 8a402408 00a06003 e0120580 78238700 21026800 0860041e 17048802 c1000704 48000410 900010ac 08048c1e 20c61811 803e2000 600383e8 |