On Target NS5B_HCV1A 0.2519084/CHEMBL367415
For the given ligand DB00176, we have found in our database that, being scored 0.2519084, the most similar ligand is CHEMBL367415. Check out the elaboration below.
| DB00176 (Given Ligand) | CHEMBL367415 (Similar Ligand) |
|---|---|
| COCCCC/C(=N/OCCN)c1ccc(C(F)(F)F)cc1 | N#Cc1c(Cl)cccc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00000000 01000000 00900102 00050f00 00080000 10000000 10000440 00002000 00108948 00080851 09110000 40008801 00000800 01a00000 00000000 00090018 00800000 02000000 80406400 00800401 00000100 08008000 03000000 00400010 00000000 80000004 48000100 92000000 0000020a 00060002 40180000 00000600 | 0005a000 01000801 00000102 00810200 00080021 00000000 04000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200008 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00000000 00000041 10004002 00020402 80000000 00420400 |