On Target NS5B_HCV1A 0.2889734/CHEMBL3644876
For the given ligand DB00833, we have found in our database that, being scored 0.2889734, the most similar ligand is CHEMBL3644876. Check out the elaboration below.
| DB00833 (Given Ligand) | CHEMBL3644876 (Similar Ligand) |
|---|---|
| N[C@@H](C(=O)N[C@@H]1C(=O)N2/C(C(=O)O)=C(Cl)\CS[C@H]12)c3ccccc3 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(C(=O)Cc2ccccc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 08400080 40006000 20124100 0c310640 01000080 00000000 002083a0 1000940c 11000480 0a0e4842 08210003 4004b000 0b01c806 000c2105 c0190001 0048004c 14000400 02000280 00010018 02700328 4000a000 3d208f80 02000203 87402018 04001200 a8000060 00404000 00040550 0c000030 c0562123 24046011 a3130680 | 00010080 0d403400 00100100 05310f00 00080000 00018000 000a0004 a0003408 10800280 005a89e8 08202400 4001b000 0f00f002 01042101 c0400400 001a8008 02824018 02082001 40610850 00004201 00000100 bc2d0e10 01000003 b3440038 02013000 80001002 00000000 9020002c 0c000200 81060293 a4186000 01012670 |