On Target RT_HIV1 0.26106194/CHEMBL4225028
For the given ligand DB00833, we have found in our database that, being scored 0.26106194, the most similar ligand is CHEMBL4225028. Check out the elaboration below.
| DB00833 (Given Ligand) | CHEMBL4225028 (Similar Ligand) |
|---|---|
| N[C@@H](C(=O)N[C@@H]1C(=O)N2/C(C(=O)O)=C(Cl)\CS[C@H]12)c3ccccc3 | C=C(C)[C@@H]1CC[C@]2(CNCCN3CCS(=O)(=O)CC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 08400080 40006000 20124100 0c310640 01000080 00000000 002083a0 1000940c 11000480 0a0e4842 08210003 4004b000 0b01c806 000c2105 c0190001 0048004c 14000400 02000280 00010018 02700328 4000a000 3d208f80 02000203 87402018 04001200 a8000060 00404000 00040550 0c000030 c0562123 24046011 a3130680 | 00000000 45000800 20100302 4c150600 00000000 00004000 80000080 20000402 00020900 021c48c0 08302000 40018800 00028006 00242000 80000402 00080008 04000400 02010020 02012000 00000201 01000100 38020a30 00008261 06580014 01200000 80000000 00406000 d0000000 08400002 01060002 e4020000 02010620 |