On Target GP_EBOV 0.24401914/CHEMBL3125897
For the given ligand DB00955, we have found in our database that, being scored 0.24401914, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| DB00955 (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CCN[C@H]2C[C@@H](N)[C@@H](O[C@H]1O/C(CN)=C\C[C@@H]1N)[C@@H](O)[C@H]2O[C@@H]3OC[C@@](C)(O)[C@@H](NC)[C@H]3O | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00000050 81000400 00100101 80010501 803800c0 00000000 000a3880 28000400 00200000 015001e0 00200000 40018000 80020002 03880000 02001008 002b9308 30a00044 00000140 13c0e000 00002201 00100020 100000b0 17008080 08100010 30000421 80000000 00400200 b4000021 00004202 00040010 0ce40000 00004a00 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |