On Target PA_INFA 0.2366864/CHEMBL2040554
For the given ligand DB00955, we have found in our database that, being scored 0.2366864, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| DB00955 (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| CCN[C@H]2C[C@@H](N)[C@@H](O[C@H]1O/C(CN)=C\C[C@@H]1N)[C@@H](O)[C@H]2O[C@@H]3OC[C@@](C)(O)[C@@H](NC)[C@H]3O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00000050 81000400 00100101 80010501 803800c0 00000000 000a3880 28000400 00200000 015001e0 00200000 40018000 80020002 03880000 02001008 002b9308 30a00044 00000140 13c0e000 00002201 00100020 100000b0 17008080 08100010 30000421 80000000 00400200 b4000021 00004202 00040010 0ce40000 00004a00 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |