On Target PA_INFA 0.24090908/CHEMBL278402
For the given ligand DB00833, we have found in our database that, being scored 0.24090908, the most similar ligand is CHEMBL278402. Check out the elaboration below.
| DB00833 (Given Ligand) | CHEMBL278402 (Similar Ligand) |
|---|---|
| N[C@@H](C(=O)N[C@@H]1C(=O)N2/C(C(=O)O)=C(Cl)\CS[C@H]12)c3ccccc3 | O=C(O)C(=O)/C=C(\O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 08400080 40006000 20124100 0c310640 01000080 00000000 002083a0 1000940c 11000480 0a0e4842 08210003 4004b000 0b01c806 000c2105 c0190001 0048004c 14000400 02000280 00010018 02700328 4000a000 3d208f80 02000203 87402018 04001200 a8000060 00404000 00040550 0c000030 c0562123 24046011 a3130680 | 00008000 01000000 00900902 00110600 00100000 00000000 000001c0 22001402 15100840 001808c2 08300200 5001d800 82028826 00200000 00000404 00080008 00004000 02000000 00450000 00000201 00000100 18008b80 01008040 00500010 00202000 c0000000 00440000 90000000 04004100 00060002 34040000 00030e00 |