On Target NS3_HCV1A 0.30769232/CHEMBL4107728
For the given ligand DB00176, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL4107728. Check out the elaboration below.
| DB00176 (Given Ligand) | CHEMBL4107728 (Similar Ligand) |
|---|---|
| COCCCC/C(=N/OCCN)c1ccc(C(F)(F)F)cc1 | CC[C@@H](N)c1ccc(C)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00000000 01000000 00900102 00050f00 00080000 10000000 10000440 00002000 00108948 00080851 09110000 40008801 00000800 01a00000 00000000 00090018 00800000 02000000 80406400 00800401 00000100 08008000 03000000 00400010 00000000 80000004 48000100 92000000 0000020a 00060002 40180000 00000600 | 00000040 00000800 00100100 02010600 00000201 00008010 00000400 01001000 00000900 00082e40 08100000 50008a00 80008840 00201000 00000000 08080008 03000200 02000000 00000400 00000001 00000100 18028200 01004000 10400014 00000000 a0000000 08000000 40800001 02000080 00068002 80040000 00000600 |