On Target RDRP_SARS2 0.14137931/CHEMBL4065616
For the given ligand DB09164, we have found in our database that, being scored 0.14137931, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| DB09164 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| CC(C)c1cccc(C(C)C)c1NC(=O)CN(CC(=O)O)CC(=O)O | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00004002 00000000 00000120 04010600 00000081 00000040 00000000 00000000 00000000 00080a40 08282024 4000a000 02008002 00102003 00320040 00080008 10248000 02000000 08000000 00000000 40100000 28000e00 22002000 02400012 00000000 80000000 00000010 00801080 08088000 00060003 00004000 20000600 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |