On Target NS5B_HCV1A 0.2994012/CHEMBL3644925
For the given ligand DB09164, we have found in our database that, being scored 0.2994012, the most similar ligand is CHEMBL3644925. Check out the elaboration below.
| DB09164 (Given Ligand) | CHEMBL3644925 (Similar Ligand) |
|---|---|
| CC(C)c1cccc(C(C)C)c1NC(=O)CN(CC(=O)O)CC(=O)O | CCC[C@H](NC(=O)[C@@H]1CN(c2ccc(-c3ccccc3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00004002 00000000 00000120 04010600 00000081 00000040 00000000 00000000 00000000 00080a40 08282024 4000a000 02008002 00102003 00320040 00080008 10248000 02000000 08000000 00000000 40100000 28000e00 22002000 02400012 00000000 80000000 00000010 00801080 08088000 00060003 00004000 20000600 | 00016006 01403c00 00100120 04010f00 20080000 00018000 00000004 a0002009 04800200 00020be0 00200004 5001b000 0e00b00a 0100a101 80020040 001a0008 00860010 02482001 0c402850 00000a01 60100100 380f0e10 31020003 0250001a 00113000 80001002 00000000 102000e0 0800c200 01060013 a0184000 00006200 |