On Target RT_HIV1 0.42574257/CHEMBL404519
For the given ligand DB01256, we have found in our database that, being scored 0.42574257, the most similar ligand is CHEMBL404519. Check out the elaboration below.
| DB01256 (Given Ligand) | CHEMBL404519 (Similar Ligand) |
|---|---|
| C=C[C@]5(C)C[C@@H](OC(=O)CS[C@H]1C[C@@H]2CC[C@H](C1)N2C)[C@@]3(C)[C@@H](C)CC[C@@]4(CCC(=O)[C@@H]34)[C@H](C)[C@H]5O | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(=O)CC(C)(C)C(=O)O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00050000 81000000 00100101 80110740 00290000 00000030 00000000 20000400 04200000 001040c0 00203000 50079000 0401802a 80840000 00000414 00081008 04820000 00000100 12402000 00000201 40000020 10000a12 01000300 00300010 08008400 00000010 00000000 90003040 00000200 01040022 24020000 05012200 | 00050040 01000000 00000100 00010300 00280000 00000000 00000000 00000400 00000000 00108008 00000000 40009000 04008008 00800000 00000400 00081008 00820000 00000100 12402000 00000001 00000020 00000a00 01000000 00000010 00000400 00000000 00000000 80000000 00000202 01000002 24020000 00000000 |