On Target PR_HIV1 0.25120774/CHEMBL449291
For the given ligand DB01256, we have found in our database that, being scored 0.25120774, the most similar ligand is CHEMBL449291. Check out the elaboration below.
| DB01256 (Given Ligand) | CHEMBL449291 (Similar Ligand) |
|---|---|
| C=C[C@]5(C)C[C@@H](OC(=O)CS[C@H]1C[C@@H]2CC[C@H](C1)N2C)[C@@]3(C)[C@@H](C)CC[C@@]4(CCC(=O)[C@@H]34)[C@H](C)[C@H]5O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCS(=O)(=O)CCOC2)cc1 |
|
|
|
|
|
|
| 00050000 81000000 00100101 80110740 00290000 00000030 00000000 20000400 04200000 001040c0 00203000 50079000 0401802a 80840000 00000414 00081008 04820000 00000100 12402000 00000201 40000020 10000a12 01000300 00300010 08008400 00000010 00000000 90003040 00000200 01040022 24020000 05012200 | 00000010 05c05409 2110050b 01b10600 000810c0 00028020 02000000 20000044 00542a00 014849e0 0830b000 60018010 00008002 80240001 81e80011 001a0008 14022000 02080000 01400800 01027603 80000120 18280c90 07100240 d9500058 02020400 8000001e 00800020 102020ec 04000600 22060013 80000000 04012670 |