On Target NS3_HCV1B 0.3488372/CHEMBL1170417
For the given ligand DB06288, we have found in our database that, being scored 0.3488372, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |