On Target ACE2_HUMAN 0.26815644/CHEMBL254495
For the given ligand DB13279, we have found in our database that, being scored 0.26815644, the most similar ligand is CHEMBL254495. Check out the elaboration below.
| DB13279 (Given Ligand) | CHEMBL254495 (Similar Ligand) |
|---|---|
| CCOC(=O)COc2ccc1c(C)c(CCN(CC)CC)c(=O)oc1c2 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(OCc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 04000040 00202008 20180108 00010600 00051233 00400120 02000000 40000250 020a6080 40080840 0c240020 4040c000 40808402 00200080 01208081 10080808 00020220 82000040 08000002 00020200 00004000 1a200a08 04204008 89580010 08000410 80004000 00000039 0a900030 46002200 01060802 00000000 00000600 | 04010000 43005008 20100108 00110600 00001080 c0004000 82000000 20000004 00000980 020a08c0 08300000 4001b000 06808002 20050080 81080001 02080008 10000000 02000000 00480008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00000000 10000040 04000200 00060003 60004000 03012600 |