On Target ACE2_HUMAN 0.30701753/CHEMBL258333
For the given ligand DB09164, we have found in our database that, being scored 0.30701753, the most similar ligand is CHEMBL258333. Check out the elaboration below.
| DB09164 (Given Ligand) | CHEMBL258333 (Similar Ligand) |
|---|---|
| CC(C)c1cccc(C(C)C)c1NC(=O)CN(CC(=O)O)CC(=O)O | O=C(CS)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00004002 00000000 00000120 04010600 00000081 00000040 00000000 00000000 00000000 00080a40 08282024 4000a000 02008002 00102003 00320040 00080008 10248000 02000000 08000000 00000000 40100000 28000e00 22002000 02400012 00000000 80000000 00000010 00801080 08088000 00060003 00004000 20000600 | 00002000 00005000 00100100 00110600 00000080 00000000 80000000 00000004 00000980 020a0840 08300000 4000b800 06008002 00040000 00000000 00080008 10020000 02000000 04400008 10000201 00000100 18200e00 13000040 85400018 00000800 80000000 00000000 00000040 04004000 00060003 20004000 02010600 |