On Target ACE2_HUMAN 0.34265736/CHEMBL257026
For the given ligand DB01256, we have found in our database that, being scored 0.34265736, the most similar ligand is CHEMBL257026. Check out the elaboration below.
| DB01256 (Given Ligand) | CHEMBL257026 (Similar Ligand) |
|---|---|
| C=C[C@]5(C)C[C@@H](OC(=O)CS[C@H]1C[C@@H]2CC[C@H](C1)N2C)[C@@]3(C)[C@@H](C)CC[C@@]4(CCC(=O)[C@@H]34)[C@H](C)[C@H]5O | O=C(O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)[C@@H](S)C1CCCCC1 |
|
|
|
|
|
|
| 00050000 81000000 00100101 80110740 00290000 00000030 00000000 20000400 04200000 001040c0 00203000 50079000 0401802a 80840000 00000414 00081008 04820000 00000100 12402000 00000201 40000020 10000a12 01000300 00300010 08008400 00000010 00000000 90003040 00000200 01040022 24020000 05012200 | 00012000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00200980 020a08c0 08300000 4003b800 0600800a 00040000 80080000 00080008 10020000 02000000 06402008 10000201 00000100 18200e10 13000140 85500018 00000800 80000000 00000000 10000040 04004000 00060003 20024000 03012600 |