On Target ACE2_HUMAN 0.30810812/CHEMBL254493
For the given ligand DB06288, we have found in our database that, being scored 0.30810812, the most similar ligand is CHEMBL254493. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL254493 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1OCc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 04010000 01005008 20100108 00110600 00001080 80004000 86000000 20000204 00000980 020a08c0 08300000 4001b0c0 06808002 00050000 81080001 02082008 90000000 02008000 00400008 00020201 00000100 18200e20 03000140 85d01418 00004800 c0002000 00000000 10000040 04000300 00070003 60004000 03012600 |