On Target RT_HIV1 0.2983871/CHEMBL3775172
For the given ligand DB00374, we have found in our database that, being scored 0.2983871, the most similar ligand is CHEMBL3775172. Check out the elaboration below.
| DB00374 (Given Ligand) | CHEMBL3775172 (Similar Ligand) |
|---|---|
| CCCCC[C@@H](O)CC[C@@H]3[C@@H](O)C[C@H]2Cc1c(cccc1OCC(=O)O)C[C@H]23 | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 04000000 43000008 2000010a 00010200 00081000 c0000002 02000000 00000201 00010810 00080840 08140000 4000c040 00808002 22a00080 01200021 00082008 00000200 82008000 00482000 00020201 00000100 08000a00 05004000 08400410 00000000 c0000001 00000008 00800000 00000302 01024002 00020000 00000400 | 00010000 01000800 00000302 40050200 00080000 00004000 80000080 00000402 00000900 00188848 08100000 40009800 04028008 00a00000 00000402 00080008 00000400 02000020 02402000 00000001 01000100 08020a20 01008020 00400014 01200000 80000000 00406000 c0000000 00400002 01020002 e4020000 00000400 |