On Target NS3_HCV1A 0.25/CHEMBL4111380
For the given ligand DB00984, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL4111380. Check out the elaboration below.
| DB00984 (Given Ligand) | CHEMBL4111380 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2[C@H]1CCC(=O)/C=C1/CC[C@@H]2[C@@H]3CC[C@@H]4OC(=O)CCc5ccccc5 | CC[C@@H](N[C@H](C)CC(N)=O)c1ccc(F)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00010040 01000008 00000100 00010300 00080000 00000000 00000080 00000402 01000800 00188840 08100000 40009000 04028008 00800000 00000400 00081008 00820000 02000020 02412008 00000001 00000120 08000a80 01008040 00400010 00200c00 80000000 00404000 80000000 00000200 01020002 24020000 00000400 | 000000c0 00000c00 00100100 02010600 00000201 00000010 10000000 03001000 00000800 00090fc0 08300000 c0009200 0c008842 00001000 00000400 08080008 03000200 02000180 00000410 00100201 00000100 18028600 01000000 30400014 00001000 e0000000 08000000 c0800001 00000180 00068012 a0040000 00002600 |