On Target NP_HCoV-OC43 0.2012987/CHEMBL3233481
For the given ligand DB06796, we have found in our database that, being scored 0.2012987, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB06796 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc2nc(COP(=O)(O)O)cc(CN(CCN(CC(=O)[O-])Cc1cc(COP(=O)(O)O)nc(C)c1O)CC(=O)[O-])c2O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000800a 0000080c 66004106 14000608 000400a5 00004004 30804000 00201400 00000300 001100c0 48200004 40002000 82008806 0002a021 00120400 020e300c 10008028 02880000 00200000 40020002 40000000 2c008a20 22800002 02400000 00006400 c0000000 0a420040 80051000 08008104 10060000 4400c080 00008220 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |