On Target NP_HCoV-OC43 0.2952381/CHEMBL3233481
For the given ligand DB09403, we have found in our database that, being scored 0.2952381, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB09403 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00005002 00001000 00100000 00000600 28000000 00000000 00000000 00000000 00000001 00000840 00280004 50019000 08008042 02100000 000a0040 00080008 00040000 00000001 08800110 00000204 40110040 18100e00 21002080 00100018 00081001 00100000 00800420 10000080 00808000 00060001 00200000 00000200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |