On Target NSP15_SARS 0.20496894/CHEMBL2441745
For the given ligand DB09403, we have found in our database that, being scored 0.20496894, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| DB09403 (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00005002 00001000 00100000 00000600 28000000 00000000 00000000 00000000 00000001 00000840 00280004 50019000 08008042 02100000 000a0040 00080008 00040000 00000001 08800110 00000204 40110040 18100e00 21002080 00100018 00081001 00100000 00800420 10000080 00808000 00060001 00200000 00000200 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |