On Target RDRP_SARS2 0.24262296/CHEMBL4065616
For the given ligand DB06796, we have found in our database that, being scored 0.24262296, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| DB06796 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| Cc2nc(COP(=O)(O)O)cc(CN(CCN(CC(=O)[O-])Cc1cc(COP(=O)(O)O)nc(C)c1O)CC(=O)[O-])c2O | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 0000800a 0000080c 66004106 14000608 000400a5 00004004 30804000 00201400 00000300 001100c0 48200004 40002000 82008806 0002a021 00120400 020e300c 10008028 02880000 00200000 40020002 40000000 2c008a20 22800002 02400000 00006400 c0000000 0a420040 80051000 08008104 10060000 4400c080 00008220 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |