On Target NS5B_HCV1B 0.13636364/CHEMBL3645194
For the given ligand DB14650, we have found in our database that, being scored 0.13636364, the most similar ligand is CHEMBL3645194. Check out the elaboration below.
| DB14650 (Given Ligand) | CHEMBL3645194 (Similar Ligand) |
|---|---|
| Cc2cc(OP(=O)(O)O)c1ccccc1c2OP(=O)(O)O | CCN(c1cc2nn(-c3ccc(Cl)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00200000 40000008 20000100 00010200 00000014 00000000 02024000 00000000 08000000 40000840 00000000 40408000 00000402 40020000 00000000 00002008 00000020 02000000 00100000 00020200 00000000 0c000008 00000000 00400000 00000100 80000000 02080000 00030000 02000000 00020000 00000000 20128000 | 0000c006 00805e08 20080902 41310e00 010c0000 00004042 02040000 02001408 00100900 000908c0 09312024 40118800 82008c27 01400201 800a0040 000e200c 04268000 02000604 08600008 00224201 c0100101 1c838f38 20800800 8360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |