On Target RT_HIV1 0.30322582/CHEMBL4225865
For the given ligand DB01196, we have found in our database that, being scored 0.30322582, the most similar ligand is CHEMBL4225865. Check out the elaboration below.
| DB01196 (Given Ligand) | CHEMBL4225865 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2c1ccc(OC(=O)N(CCCl)CCCl)cc1CC[C@H]2[C@H]3CC[C@H]4O | C=C(C)[C@@H]1CC[C@]2(CN(CCN(C)C)C(=O)CCC(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00048000 43000008 6000010a 00010600 00081000 40000202 02040000 00000001 04000a00 00080840 08300000 40008000 00008a02 20a00000 01010021 001a0008 a0020200 02000100 02482000 00020201 00000100 08000d10 11004000 00402018 00000000 88010023 00120000 00000000 00000202 01060003 80020000 10020600 | 00060000 01003800 00100302 44050600 00100000 00004000 80000080 2000040a 00000900 001808c0 08300000 40019800 04028002 00202000 00000402 00080008 00000400 02000020 02412000 00000201 01000100 38060e30 01008021 0250001c 01200000 80000000 00406000 d0000000 08400002 01060003 e4020000 00802e00 |