On Target PR_HIV1 0.1491228/CHEMBL492666
For the given ligand DB06796, we have found in our database that, being scored 0.1491228, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| DB06796 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| Cc2nc(COP(=O)(O)O)cc(CN(CCN(CC(=O)[O-])Cc1cc(COP(=O)(O)O)nc(C)c1O)CC(=O)[O-])c2O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 0000800a 0000080c 66004106 14000608 000400a5 00004004 30804000 00201400 00000300 001100c0 48200004 40002000 82008806 0002a021 00120400 020e300c 10008028 02880000 00200000 40020002 40000000 2c008a20 22800002 02400000 00006400 c0000000 0a420040 80051000 08008104 10060000 4400c080 00008220 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |